C14H6BrF5O — CID 89351151
3-bromo-2,4,5,8,8-pentafluoro-7-phenylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (PubChem CID 89351151) has the molecular formula C14H6BrF5O and a molecular weight of 365.10 g/mol. Its IUPAC name is 3-bromo-2,4,5,8,8-pentafluoro-7-phenylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
| Compound Name | 3-bromo-2,4,5,8,8-pentafluoro-7-phenylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
|---|---|
| PubChem CID | 89351151 |
| Molecular Formula | C14H6BrF5O |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 3-bromo-2,4,5,8,8-pentafluoro-7-phenylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| SMILES | OC1(c2ccccc2)c2c(F)c(F)c(Br)c(F)c2C1(F)F |
| InChI | InChI=1S/C14H6BrF5O/c15-9-10(16)8-7(11(17)12(9)18)13(21,14(8,19)20)6-4-2-1-3-5-6/h1-5,21H |
| InChIKey | HGVQCJCPPBGNFE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|