C28H23NO8 — CID 89351269
[(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-(2-oxoethyl)oxolan-3-yl]methyl benzoate (PubChem CID 89351269) has the molecular formula C28H23NO8 and a molecular weight of 501.49 g/mol. Its IUPAC name is [(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-(2-oxoethyl)oxolan-3-yl]methyl benzoate.
| Compound Name | [(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-(2-oxoethyl)oxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 89351269 |
| Molecular Formula | C28H23NO8 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | [(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-(2-oxoethyl)oxolan-3-yl]methyl benzoate |
| SMILES | O=CC[C@H]1OC(=O)[C@@](COC(=O)c2ccccc2)(NC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23NO8/c30-17-16-22-23(37-26(33)21-14-8-3-9-15-21)28(27(34)36-22,29-24(31)19-10-4-1-5-11-19)18-35-25(32)20-12-6-2-7-13-20/h1-15,17,22-23H,16,18H2,(H,29,31)/t22-,23+,28+/m1/s1 |
| InChIKey | MMRBPSSVJJKSFA-IWHLBADBSA-N |
| XLogP | 2.75 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|