About 3,4,6-triethyl-4,5-dihydropyridazine
3,4,6-triethyl-4,5-dihydropyridazine (PubChem CID 89351667) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3,4,6-triethyl-4,5-dihydropyridazine.
Molecular Properties
| Compound Name | 3,4,6-triethyl-4,5-dihydropyridazine |
| PubChem CID | 89351667 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3,4,6-triethyl-4,5-dihydropyridazine |
| SMILES | CCC1=NN=C(CC)C(CC)C1 |
| InChI | InChI=1S/C10H18N2/c1-4-8-7-9(5-2)11-12-10(8)6-3/h8H,4-7H2,1-3H3 |
| InChIKey | OPKFADWEJLNOPG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4,6-triethyl-4,5-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6-triethyl-4,5-dihydropyridazine?
The IUPAC name of 3,4,6-triethyl-4,5-dihydropyridazine (CID 89351667) is 3,4,6-triethyl-4,5-dihydropyridazine.
What is the SMILES notation for 3,4,6-triethyl-4,5-dihydropyridazine?
The canonical SMILES for 3,4,6-triethyl-4,5-dihydropyridazine is CCC1=NN=C(CC)C(CC)C1.
What is the InChIKey of 3,4,6-triethyl-4,5-dihydropyridazine?
The InChIKey is OPKFADWEJLNOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-8-7-9(5-2)11-12-10(8)6-3/h8H,4-7H2,1-3H3.
What are the key properties of 3,4,6-triethyl-4,5-dihydropyridazine?
3,4,6-triethyl-4,5-dihydropyridazine has a molecular weight of 166.27 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-triethyl-4,5-dihydropyridazine is sourced from PubChem (CID 89351667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).