C22H29N4+ — CID 89351734
5-(3-aminopropyl)-6-cyclohexa-2,4-dien-1-yl-1,2,6a,7-tetrahydrophenanthridin-5-ium-3,8-diamine (PubChem CID 89351734) has the molecular formula C22H29N4+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 5-(3-aminopropyl)-6-cyclohexa-2,4-dien-1-yl-1,2,6a,7-tetrahydrophenanthridin-5-ium-3,8-diamine.
| Compound Name | 5-(3-aminopropyl)-6-cyclohexa-2,4-dien-1-yl-1,2,6a,7-tetrahydrophenanthridin-5-ium-3,8-diamine |
|---|---|
| PubChem CID | 89351734 |
| Molecular Formula | C22H29N4+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 5-(3-aminopropyl)-6-cyclohexa-2,4-dien-1-yl-1,2,6a,7-tetrahydrophenanthridin-5-ium-3,8-diamine |
| SMILES | NCCC[N+]1=C(C2C=CC=CC2)C2CC(N)=CC=C2C2=C1C=C(N)CC2 |
| InChI | InChI=1S/C22H29N4/c23-11-4-12-26-21-14-17(25)8-10-19(21)18-9-7-16(24)13-20(18)22(26)15-5-2-1-3-6-15/h1-3,5,7,9,14-15,20H,4,6,8,10-13,23-25H2/q+1 |
| InChIKey | HJHNMKROQLYAAA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|