C8H11ClN4OS — CID 89351742
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-imine (PubChem CID 89351742) has the molecular formula C8H11ClN4OS and a molecular weight of 246.72 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-imine.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-imine |
|---|---|
| PubChem CID | 89351742 |
| Molecular Formula | C8H11ClN4OS |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-imine |
| SMILES | [H]/N=C1\N(C)COCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C8H11ClN4OS/c1-12-4-14-5-13(8(12)10)3-6-2-11-7(9)15-6/h2,10H,3-5H2,1H3/b10-8+ |
| InChIKey | JDTUGRDKAOPKRI-CSKARUKUSA-N |
| XLogP | 1.41 |
| TPSA | 52.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|