About 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete
2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete (PubChem CID 89351745) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete.
Molecular Properties
| Compound Name | 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete |
| PubChem CID | 89351745 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete |
| SMILES | C/C=C(/C)C(C1=NC=C1)=C(C)C |
| InChI | InChI=1S/C11H15N/c1-5-9(4)11(8(2)3)10-6-7-12-10/h5-7H,1-4H3/b9-5- |
| InChIKey | FVDRVFHMMMILLD-UITAMQMPSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete?
The IUPAC name of 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete (CID 89351745) is 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete.
What is the SMILES notation for 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete?
The canonical SMILES for 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete is C/C=C(/C)C(C1=NC=C1)=C(C)C.
What is the InChIKey of 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete?
The InChIKey is FVDRVFHMMMILLD-UITAMQMPSA-N. The full InChI is InChI=1S/C11H15N/c1-5-9(4)11(8(2)3)10-6-7-12-10/h5-7H,1-4H3/b9-5-.
What are the key properties of 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete?
2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete has a molecular weight of 161.25 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]azete is sourced from PubChem (CID 89351745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).