About N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide
N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide (PubChem CID 89352113) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide |
| PubChem CID | 89352113 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCCC)CCC(F)F |
| InChI | InChI=1S/C11H19F2NO/c1-4-5-7-14(8-6-10(12)13)11(15)9(2)3/h10H,2,4-8H2,1,3H3 |
| InChIKey | KMSZYHIYGBENFC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide?
The IUPAC name of N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide (CID 89352113) is N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide.
What is the SMILES notation for N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide?
The canonical SMILES for N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide is C=C(C)C(=O)N(CCCC)CCC(F)F.
What is the InChIKey of N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide?
The InChIKey is KMSZYHIYGBENFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO/c1-4-5-7-14(8-6-10(12)13)11(15)9(2)3/h10H,2,4-8H2,1,3H3.
What are the key properties of N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide?
N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide has a molecular weight of 219.27 g/mol, XLogP of 2.85, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(3,3-difluoropropyl)-2-methylprop-2-enamide is sourced from PubChem (CID 89352113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).