About N-(5,5-difluoropentyl)-N-ethylprop-2-enamide
N-(5,5-difluoropentyl)-N-ethylprop-2-enamide (PubChem CID 89352171) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is N-(5,5-difluoropentyl)-N-ethylprop-2-enamide.
Molecular Properties
| Compound Name | N-(5,5-difluoropentyl)-N-ethylprop-2-enamide |
| PubChem CID | 89352171 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(5,5-difluoropentyl)-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CCCCC(F)F |
| InChI | InChI=1S/C10H17F2NO/c1-3-10(14)13(4-2)8-6-5-7-9(11)12/h3,9H,1,4-8H2,2H3 |
| InChIKey | QXDLDMZDWKXKSF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5,5-difluoropentyl)-N-ethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-difluoropentyl)-N-ethylprop-2-enamide?
The IUPAC name of N-(5,5-difluoropentyl)-N-ethylprop-2-enamide (CID 89352171) is N-(5,5-difluoropentyl)-N-ethylprop-2-enamide.
What is the SMILES notation for N-(5,5-difluoropentyl)-N-ethylprop-2-enamide?
The canonical SMILES for N-(5,5-difluoropentyl)-N-ethylprop-2-enamide is C=CC(=O)N(CC)CCCCC(F)F.
What is the InChIKey of N-(5,5-difluoropentyl)-N-ethylprop-2-enamide?
The InChIKey is QXDLDMZDWKXKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-3-10(14)13(4-2)8-6-5-7-9(11)12/h3,9H,1,4-8H2,2H3.
What are the key properties of N-(5,5-difluoropentyl)-N-ethylprop-2-enamide?
N-(5,5-difluoropentyl)-N-ethylprop-2-enamide has a molecular weight of 205.25 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-difluoropentyl)-N-ethylprop-2-enamide is sourced from PubChem (CID 89352171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).