About N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride
N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride (PubChem CID 89352322) has the molecular formula C6H7Cl3N2
and a molecular weight of 213.49 g/mol. Its IUPAC name is N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride.
Molecular Properties
| Compound Name | N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride |
| PubChem CID | 89352322 |
| Molecular Formula | C6H7Cl3N2 |
| Molecular Weight | 213.49 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride |
| SMILES | C=C(Cl)/C(Cl)=C(C)\N=C(\N)Cl |
| InChI | InChI=1S/C6H7Cl3N2/c1-3(7)5(8)4(2)11-6(9)10/h1H2,2H3,(H2,10,11)/b5-4+ |
| InChIKey | HNNHLMYELPYOOT-SNAWJCMRSA-N |
| XLogP | 2.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride?
The IUPAC name of N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride (CID 89352322) is N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride.
What is the SMILES notation for N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride?
The canonical SMILES for N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride is C=C(Cl)/C(Cl)=C(C)\N=C(\N)Cl.
What is the InChIKey of N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride?
The InChIKey is HNNHLMYELPYOOT-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H7Cl3N2/c1-3(7)5(8)4(2)11-6(9)10/h1H2,2H3,(H2,10,11)/b5-4+.
What are the key properties of N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride?
N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride has a molecular weight of 213.49 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2E)-3,4-dichloropenta-2,4-dien-2-yl]carbamimidoyl chloride is sourced from PubChem (CID 89352322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).