C34H36N6 — CID 89352513
4-N-[4-(4-amino-N-(4-amino-3-methylphenyl)-3-methylanilino)phenyl]-4-N-(4-amino-3-methylphenyl)-2-methylbenzene-1,4-diamine (PubChem CID 89352513) has the molecular formula C34H36N6 and a molecular weight of 528.70 g/mol. Its IUPAC name is 4-N-[4-(4-amino-N-(4-amino-3-methylphenyl)-3-methylanilino)phenyl]-4-N-(4-amino-3-methylphenyl)-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-amino-N-(4-amino-3-methylphenyl)-3-methylanilino)phenyl]-4-N-(4-amino-3-methylphenyl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 89352513 |
| Molecular Formula | C34H36N6 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 4-N-[4-(4-amino-N-(4-amino-3-methylphenyl)-3-methylanilino)phenyl]-4-N-(4-amino-3-methylphenyl)-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N(c2ccc(N(c3ccc(N)c(C)c3)c3ccc(N)c(C)c3)cc2)c2ccc(N)c(C)c2)ccc1N |
| InChI | InChI=1S/C34H36N6/c1-21-17-27(9-13-31(21)35)39(28-10-14-32(36)22(2)18-28)25-5-7-26(8-6-25)40(29-11-15-33(37)23(3)19-29)30-12-16-34(38)24(4)20-30/h5-20H,35-38H2,1-4H3 |
| InChIKey | JDFGBXMDWWJHDW-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|