C11H15NO2 — CID 89352538
(3Z,5E)-3-(ethylideneamino)-6-methylocta-3,5-diene-2,7-dione (PubChem CID 89352538) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3Z,5E)-3-(ethylideneamino)-6-methylocta-3,5-diene-2,7-dione.
| Compound Name | (3Z,5E)-3-(ethylideneamino)-6-methylocta-3,5-diene-2,7-dione |
|---|---|
| PubChem CID | 89352538 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3Z,5E)-3-(ethylideneamino)-6-methylocta-3,5-diene-2,7-dione |
| SMILES | C/C=N/C(=C\C=C(/C)C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H15NO2/c1-5-12-11(10(4)14)7-6-8(2)9(3)13/h5-7H,1-4H3/b8-6+,11-7-,12-5+ |
| InChIKey | WPLFDQAZQMJHLU-FURROJBISA-N |
| XLogP | 2.09 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|