C24H31O3PS — CID 89352790
[(1S,2S,3S,5R)-6,6-dimethyl-2-[[methylidene(diphenyl)-λ5-phosphanyl]methyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate (PubChem CID 89352790) has the molecular formula C24H31O3PS and a molecular weight of 430.55 g/mol. Its IUPAC name is [(1S,2S,3S,5R)-6,6-dimethyl-2-[[methylidene(diphenyl)-λ5-phosphanyl]methyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate.
| Compound Name | [(1S,2S,3S,5R)-6,6-dimethyl-2-[[methylidene(diphenyl)-λ5-phosphanyl]methyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate |
|---|---|
| PubChem CID | 89352790 |
| Molecular Formula | C24H31O3PS |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [(1S,2S,3S,5R)-6,6-dimethyl-2-[[methylidene(diphenyl)-λ5-phosphanyl]methyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate |
| SMILES | C=P(C[C@@H]1[C@@H](OS(C)(=O)=O)C[C@H]2C[C@@H]1C2(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31O3PS/c1-24(2)18-15-22(24)21(23(16-18)27-29(4,25)26)17-28(3,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18,21-23H,3,15-17H2,1-2,4H3/t18-,21+,22+,23+/m1/s1 |
| InChIKey | VRLVZCXIICXBOR-PVSGBFIBSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|