C29H30NOP — CID 89352972
diphenyl-[2-[(1S,2S,6R,7S)-1,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-en-4-yl]phenyl]phosphane (PubChem CID 89352972) has the molecular formula C29H30NOP and a molecular weight of 439.54 g/mol. Its IUPAC name is diphenyl-[2-[(1S,2S,6R,7S)-1,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-en-4-yl]phenyl]phosphane.
| Compound Name | diphenyl-[2-[(1S,2S,6R,7S)-1,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-en-4-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 89352972 |
| Molecular Formula | C29H30NOP |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | diphenyl-[2-[(1S,2S,6R,7S)-1,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-en-4-yl]phenyl]phosphane |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H]1OC(c3ccccc3P(c3ccccc3)c3ccccc3)=N[C@H]21 |
| InChI | InChI=1S/C29H30NOP/c1-28(2)23-18-19-29(28,3)26-25(23)30-27(31-26)22-16-10-11-17-24(22)32(20-12-6-4-7-13-20)21-14-8-5-9-15-21/h4-17,23,25-26H,18-19H2,1-3H3/t23-,25-,26-,29-/m1/s1 |
| InChIKey | UENQLYRDUWFELH-CTDWIVFPSA-N |
| XLogP | 5.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|