About benzene;4-ethylmorpholine;oxocobalt
benzene;4-ethylmorpholine;oxocobalt (PubChem CID 89353225) has the molecular formula C12H17CoNO2-2
and a molecular weight of 266.21 g/mol. Its IUPAC name is benzene;4-ethylmorpholine;oxocobalt.
Molecular Properties
| Compound Name | benzene;4-ethylmorpholine;oxocobalt |
| PubChem CID | 89353225 |
| Molecular Formula | C12H17CoNO2-2 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | benzene;4-ethylmorpholine;oxocobalt |
| SMILES | O=[Co].[CH2-]CN1CCOCC1.[c-]1ccccc1 |
| InChI | InChI=1S/C6H12NO.C6H5.Co.O/c1-2-7-3-5-8-6-4-7;1-2-4-6-5-3-1;;/h1-6H2;1-5H;;/q2*-1;; |
| InChIKey | OJOCZATZSFWWIF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;4-ethylmorpholine;oxocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-ethylmorpholine;oxocobalt?
The IUPAC name of benzene;4-ethylmorpholine;oxocobalt (CID 89353225) is benzene;4-ethylmorpholine;oxocobalt.
What is the SMILES notation for benzene;4-ethylmorpholine;oxocobalt?
The canonical SMILES for benzene;4-ethylmorpholine;oxocobalt is O=[Co].[CH2-]CN1CCOCC1.[c-]1ccccc1.
What is the InChIKey of benzene;4-ethylmorpholine;oxocobalt?
The InChIKey is OJOCZATZSFWWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NO.C6H5.Co.O/c1-2-7-3-5-8-6-4-7;1-2-4-6-5-3-1;;/h1-6H2;1-5H;;/q2*-1;;.
What are the key properties of benzene;4-ethylmorpholine;oxocobalt?
benzene;4-ethylmorpholine;oxocobalt has a molecular weight of 266.21 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-ethylmorpholine;oxocobalt is sourced from PubChem (CID 89353225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).