C27H56O7Si — CID 89353243
hydroxy-dimethyl-[2-methyl-4-[(2R,3R,4S,5S,6S)-3,4,5-tributoxy-6-(methoxymethoxymethyl)oxan-2-yl]butan-2-yl]silane (PubChem CID 89353243) has the molecular formula C27H56O7Si and a molecular weight of 520.82 g/mol. Its IUPAC name is hydroxy-dimethyl-[2-methyl-4-[(2R,3R,4S,5S,6S)-3,4,5-tributoxy-6-(methoxymethoxymethyl)oxan-2-yl]butan-2-yl]silane.
| Compound Name | hydroxy-dimethyl-[2-methyl-4-[(2R,3R,4S,5S,6S)-3,4,5-tributoxy-6-(methoxymethoxymethyl)oxan-2-yl]butan-2-yl]silane |
|---|---|
| PubChem CID | 89353243 |
| Molecular Formula | C27H56O7Si |
| Molecular Weight | 520.82 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | hydroxy-dimethyl-[2-methyl-4-[(2R,3R,4S,5S,6S)-3,4,5-tributoxy-6-(methoxymethoxymethyl)oxan-2-yl]butan-2-yl]silane |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@H](COCOC)O[C@H](CCC(C)(C)[Si](C)(C)O)[C@H]1OCCCC |
| InChI | InChI=1S/C27H56O7Si/c1-9-12-17-31-24-22(15-16-27(4,5)35(7,8)28)34-23(20-30-21-29-6)25(32-18-13-10-2)26(24)33-19-14-11-3/h22-26,28H,9-21H2,1-8H3/t22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | WJSCQXXEQDCBTD-NRWDCXGPSA-N |
| XLogP | 5.69 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|