C21H38F2O6 — CID 89353244
(3S,4R,5S,6S)-3,4,5-tributoxy-2-(difluoromethylidene)-6-(methoxymethoxymethyl)oxane (PubChem CID 89353244) has the molecular formula C21H38F2O6 and a molecular weight of 424.53 g/mol. Its IUPAC name is (3S,4R,5S,6S)-3,4,5-tributoxy-2-(difluoromethylidene)-6-(methoxymethoxymethyl)oxane.
| Compound Name | (3S,4R,5S,6S)-3,4,5-tributoxy-2-(difluoromethylidene)-6-(methoxymethoxymethyl)oxane |
|---|---|
| PubChem CID | 89353244 |
| Molecular Formula | C21H38F2O6 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (3S,4R,5S,6S)-3,4,5-tributoxy-2-(difluoromethylidene)-6-(methoxymethoxymethyl)oxane |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@H](OCCCC)C(=C(F)F)O[C@H]1COCOC |
| InChI | InChI=1S/C21H38F2O6/c1-5-8-11-26-17-16(14-25-15-24-4)29-20(21(22)23)19(28-13-10-7-3)18(17)27-12-9-6-2/h16-19H,5-15H2,1-4H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | LYMYBHGQJCPGCI-OKYOBFRVSA-N |
| XLogP | 4.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|