About 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine
1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine (PubChem CID 89353532) has the molecular formula C16H22ClNO2S2
and a molecular weight of 359.94 g/mol. Its IUPAC name is 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine.
Molecular Properties
| Compound Name | 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine |
| PubChem CID | 89353532 |
| Molecular Formula | C16H22ClNO2S2 |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine |
| SMILES | CCC1CCN(S(=O)(=O)C2Sc3ccc(Cl)cc3C2C)CC1 |
| InChI | InChI=1S/C16H22ClNO2S2/c1-3-12-6-8-18(9-7-12)22(19,20)16-11(2)14-10-13(17)4-5-15(14)21-16/h4-5,10-12,16H,3,6-9H2,1-2H3 |
| InChIKey | CIZBAZQAZNCEBF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine?
The IUPAC name of 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine (CID 89353532) is 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine.
What is the SMILES notation for 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine?
The canonical SMILES for 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine is CCC1CCN(S(=O)(=O)C2Sc3ccc(Cl)cc3C2C)CC1.
What is the InChIKey of 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine?
The InChIKey is CIZBAZQAZNCEBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClNO2S2/c1-3-12-6-8-18(9-7-12)22(19,20)16-11(2)14-10-13(17)4-5-15(14)21-16/h4-5,10-12,16H,3,6-9H2,1-2H3.
What are the key properties of 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine?
1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine has a molecular weight of 359.94 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-3-methyl-2,3-dihydro-1-benzothiophen-2-yl)sulfonyl]-4-ethylpiperidine is sourced from PubChem (CID 89353532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).