C13H13F3N2O2 — CID 89354073
2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(trifluoromethyl)pyrazol-1-yl]acetic acid (PubChem CID 89354073) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(trifluoromethyl)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(trifluoromethyl)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 89354073 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(trifluoromethyl)pyrazol-1-yl]acetic acid |
| SMILES | C=C/C=C\C(=C/C)c1cc(C(F)(F)F)nn1CC(=O)O |
| InChI | InChI=1S/C13H13F3N2O2/c1-3-5-6-9(4-2)10-7-11(13(14,15)16)17-18(10)8-12(19)20/h3-7H,1,8H2,2H3,(H,19,20)/b6-5-,9-4+ |
| InChIKey | TVRJJQIYZIVFGM-CXBDEZGUSA-N |
| XLogP | 3.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|