C11H17NO2 — CID 89354746
(2Z,4Z)-2-ethenyl-3-hydroxy-N,N,4-trimethylhexa-2,4-dienamide (PubChem CID 89354746) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-3-hydroxy-N,N,4-trimethylhexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-2-ethenyl-3-hydroxy-N,N,4-trimethylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 89354746 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-3-hydroxy-N,N,4-trimethylhexa-2,4-dienamide |
| SMILES | C=C/C(C(=O)N(C)C)=C(O)\C(C)=C/C |
| InChI | InChI=1S/C11H17NO2/c1-6-8(3)10(13)9(7-2)11(14)12(4)5/h6-7,13H,2H2,1,3-5H3/b8-6-,10-9- |
| InChIKey | UTDLGQSUNJJZCA-VAOAJWRNSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|