About 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine
1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine (PubChem CID 89354989) has the molecular formula C17H23N5
and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine |
| PubChem CID | 89354989 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine |
| SMILES | Cc1ccc(/N=N/c2ccc(N(C(C)N)C(C)N)cc2)cc1 |
| InChI | InChI=1S/C17H23N5/c1-12-4-6-15(7-5-12)20-21-16-8-10-17(11-9-16)22(13(2)18)14(3)19/h4-11,13-14H,18-19H2,1-3H3/b21-20+ |
| InChIKey | FVNLZVPSTAGMKG-QZQOTICOSA-N |
| XLogP | 3.83 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine?
The IUPAC name of 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine (CID 89354989) is 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine.
What is the SMILES notation for 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine?
The canonical SMILES for 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine is Cc1ccc(/N=N/c2ccc(N(C(C)N)C(C)N)cc2)cc1.
What is the InChIKey of 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine?
The InChIKey is FVNLZVPSTAGMKG-QZQOTICOSA-N. The full InChI is InChI=1S/C17H23N5/c1-12-4-6-15(7-5-12)20-21-16-8-10-17(11-9-16)22(13(2)18)14(3)19/h4-11,13-14H,18-19H2,1-3H3/b21-20+.
What are the key properties of 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine?
1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine has a molecular weight of 297.41 g/mol, XLogP of 3.83, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-(1-aminoethyl)-1-N'-[4-[(4-methylphenyl)diazenyl]phenyl]ethane-1,1-diamine is sourced from PubChem (CID 89354989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).