C12H21NO2 — CID 89354999
2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]acetaldehyde (PubChem CID 89354999) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]acetaldehyde.
| Compound Name | 2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 89354999 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]acetaldehyde |
| SMILES | CC(C)(C)C(=O)N1CCC(CC=O)CC1 |
| InChI | InChI=1S/C12H21NO2/c1-12(2,3)11(15)13-7-4-10(5-8-13)6-9-14/h9-10H,4-8H2,1-3H3 |
| InChIKey | YTGOVWAKVAKZAM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|