C19H34N2 — CID 89355263
(1E,3Z,5E)-3,6,7,7-tetramethyl-N-(2-piperidin-1-ylethyl)octa-1,3,5-trien-1-amine (PubChem CID 89355263) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is (1E,3Z,5E)-3,6,7,7-tetramethyl-N-(2-piperidin-1-ylethyl)octa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5E)-3,6,7,7-tetramethyl-N-(2-piperidin-1-ylethyl)octa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89355263 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | (1E,3Z,5E)-3,6,7,7-tetramethyl-N-(2-piperidin-1-ylethyl)octa-1,3,5-trien-1-amine |
| SMILES | CC(=C/C=C(\C)C(C)(C)C)/C=C/NCCN1CCCCC1 |
| InChI | InChI=1S/C19H34N2/c1-17(9-10-18(2)19(3,4)5)11-12-20-13-16-21-14-7-6-8-15-21/h9-12,20H,6-8,13-16H2,1-5H3/b12-11+,17-9-,18-10+ |
| InChIKey | ZPMBYVUZSGCKPL-JUFGMBAYSA-N |
| XLogP | 4.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|