C14H20F3NO — CID 89355269
4-[(1E,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trienoxy]piperidine (PubChem CID 89355269) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[(1E,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trienoxy]piperidine.
| Compound Name | 4-[(1E,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trienoxy]piperidine |
|---|---|
| PubChem CID | 89355269 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[(1E,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trienoxy]piperidine |
| SMILES | C/C=C(\C=C(C)/C=C/OC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO/c1-3-12(14(15,16)17)10-11(2)6-9-19-13-4-7-18-8-5-13/h3,6,9-10,13,18H,4-5,7-8H2,1-2H3/b9-6+,11-10-,12-3+ |
| InChIKey | WDUFGMULTDLHDB-DHQVDSTGSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|