C10H16N2O — CID 89355272
(1Z,3Z)-5-(azetidin-3-yloxy)-3-methylhexa-1,3,5-trien-1-amine (PubChem CID 89355272) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (1Z,3Z)-5-(azetidin-3-yloxy)-3-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-5-(azetidin-3-yloxy)-3-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89355272 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (1Z,3Z)-5-(azetidin-3-yloxy)-3-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C(C)\C=C/N)OC1CNC1 |
| InChI | InChI=1S/C10H16N2O/c1-8(3-4-11)5-9(2)13-10-6-12-7-10/h3-5,10,12H,2,6-7,11H2,1H3/b4-3-,8-5- |
| InChIKey | GMFAMQGLMXAKCL-UBNNFMAXSA-N |
| XLogP | 0.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|