C20H22FNO5 — CID 8935528
[(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] (2R)-2-(4-fluorophenoxy)propanoate (PubChem CID 8935528) has the molecular formula C20H22FNO5 and a molecular weight of 375.40 g/mol. Its IUPAC name is [(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] (2R)-2-(4-fluorophenoxy)propanoate.
| Compound Name | [(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] (2R)-2-(4-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 8935528 |
| Molecular Formula | C20H22FNO5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] (2R)-2-(4-fluorophenoxy)propanoate |
| SMILES | CCOc1ccc(NC(=O)[C@H](C)OC(=O)[C@@H](C)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FNO5/c1-4-25-17-11-7-16(8-12-17)22-19(23)13(2)27-20(24)14(3)26-18-9-5-15(21)6-10-18/h5-14H,4H2,1-3H3,(H,22,23)/t13-,14+/m0/s1 |
| InChIKey | GWJJPJLCDXVPIB-UONOGXRCSA-N |
| XLogP | 3.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |