C17H26F3N — CID 89355344
1-[(4E,6Z,8E)-6-methyl-8-(trifluoromethyl)deca-4,6,8-trienyl]piperidine (PubChem CID 89355344) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is 1-[(4E,6Z,8E)-6-methyl-8-(trifluoromethyl)deca-4,6,8-trienyl]piperidine.
| Compound Name | 1-[(4E,6Z,8E)-6-methyl-8-(trifluoromethyl)deca-4,6,8-trienyl]piperidine |
|---|---|
| PubChem CID | 89355344 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 1-[(4E,6Z,8E)-6-methyl-8-(trifluoromethyl)deca-4,6,8-trienyl]piperidine |
| SMILES | C/C=C(\C=C(C)/C=C/CCCN1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C17H26F3N/c1-3-16(17(18,19)20)14-15(2)10-6-4-7-11-21-12-8-5-9-13-21/h3,6,10,14H,4-5,7-9,11-13H2,1-2H3/b10-6+,15-14-,16-3+ |
| InChIKey | ZCFJXYLLAHSHBQ-KRFXCCOWSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|