C27H30N6S — CID 89355425
4-[(1R,5S)-3-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-azabicyclo[3.1.0]hexan-1-yl]aniline (PubChem CID 89355425) has the molecular formula C27H30N6S and a molecular weight of 470.65 g/mol. Its IUPAC name is 4-[(1R,5S)-3-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-azabicyclo[3.1.0]hexan-1-yl]aniline.
| Compound Name | 4-[(1R,5S)-3-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-azabicyclo[3.1.0]hexan-1-yl]aniline |
|---|---|
| PubChem CID | 89355425 |
| Molecular Formula | C27H30N6S |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 4-[(1R,5S)-3-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-azabicyclo[3.1.0]hexan-1-yl]aniline |
| SMILES | Cc1ccc2c(-c3nnc(SCCCN4C[C@H]5C[C@@]5(c5ccc(N)cc5)C4)n3C)cccc2n1 |
| InChI | InChI=1S/C27H30N6S/c1-18-7-12-22-23(5-3-6-24(22)29-18)25-30-31-26(32(25)2)34-14-4-13-33-16-20-15-27(20,17-33)19-8-10-21(28)11-9-19/h3,5-12,20H,4,13-17,28H2,1-2H3/t20-,27+/m1/s1 |
| InChIKey | REHPOMXYTXWTQP-HRFSGMKKSA-N |
| XLogP | 4.68 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|