About (4S)-1,1-dibromo-4-methylhex-1-ene
(4S)-1,1-dibromo-4-methylhex-1-ene (PubChem CID 89355525) has the molecular formula C7H12Br2
and a molecular weight of 255.98 g/mol. Its IUPAC name is (4S)-1,1-dibromo-4-methylhex-1-ene.
Molecular Properties
| Compound Name | (4S)-1,1-dibromo-4-methylhex-1-ene |
| PubChem CID | 89355525 |
| Molecular Formula | C7H12Br2 |
| Molecular Weight | 255.98 g/mol |
| Exact Mass | 253.93 |
| IUPAC Name | (4S)-1,1-dibromo-4-methylhex-1-ene |
| SMILES | CC[C@H](C)CC=C(Br)Br |
| InChI | InChI=1S/C7H12Br2/c1-3-6(2)4-5-7(8)9/h5-6H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | TZKHLQJHCQNZLW-LURJTMIESA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4S)-1,1-dibromo-4-methylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,1-dibromo-4-methylhex-1-ene?
The IUPAC name of (4S)-1,1-dibromo-4-methylhex-1-ene (CID 89355525) is (4S)-1,1-dibromo-4-methylhex-1-ene.
What is the SMILES notation for (4S)-1,1-dibromo-4-methylhex-1-ene?
The canonical SMILES for (4S)-1,1-dibromo-4-methylhex-1-ene is CC[C@H](C)CC=C(Br)Br.
What is the InChIKey of (4S)-1,1-dibromo-4-methylhex-1-ene?
The InChIKey is TZKHLQJHCQNZLW-LURJTMIESA-N. The full InChI is InChI=1S/C7H12Br2/c1-3-6(2)4-5-7(8)9/h5-6H,3-4H2,1-2H3/t6-/m0/s1.
What are the key properties of (4S)-1,1-dibromo-4-methylhex-1-ene?
(4S)-1,1-dibromo-4-methylhex-1-ene has a molecular weight of 255.98 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,1-dibromo-4-methylhex-1-ene is sourced from PubChem (CID 89355525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).