C42H43NO6 — CID 89356093
3-[4-[1-[4-[(E)-2,3-dihydroxyprop-2-enoxy]phenyl]-2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol (PubChem CID 89356093) has the molecular formula C42H43NO6 and a molecular weight of 657.81 g/mol. Its IUPAC name is 3-[4-[1-[4-[(E)-2,3-dihydroxyprop-2-enoxy]phenyl]-2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[1-[4-[(E)-2,3-dihydroxyprop-2-enoxy]phenyl]-2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 89356093 |
| Molecular Formula | C42H43NO6 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | 3-[4-[1-[4-[(E)-2,3-dihydroxyprop-2-enoxy]phenyl]-2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol |
| SMILES | Cc1ccc(N(c2ccc(C=C(c3ccc(OC/C(O)=C\O)cc3)c3ccc(OCC(O)CO)cc3)cc2)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C42H43NO6/c1-28-5-13-36(21-30(28)3)43(37-14-6-29(2)31(4)22-37)35-15-7-32(8-16-35)23-42(33-9-17-40(18-10-33)48-26-38(46)24-44)34-11-19-41(20-12-34)49-27-39(47)25-45/h5-24,39,44-47H,25-27H2,1-4H3/b38-24+,42-23? |
| InChIKey | BSCQIHRCBUMRLZ-VQMVAORNSA-N |
| XLogP | 9.05 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|