About (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine
(2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine (PubChem CID 89356100) has the molecular formula C20H21N
and a molecular weight of 275.39 g/mol. Its IUPAC name is (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine.
Molecular Properties
| Compound Name | (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine |
| PubChem CID | 89356100 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine |
| SMILES | [H]/N=C/C1(C)c2cc(C(C)(C)C)c#cc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C20H21N/c1-13-6-8-15-16-9-7-14(19(2,3)4)11-18(16)20(5,12-21)17(15)10-13/h6,8,10-12,21H,1-5H3/b21-12+ |
| InChIKey | ASIZRWYYPMFQBA-CIAFOILYSA-N |
| XLogP | 4.83 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine?
The IUPAC name of (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine (CID 89356100) is (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine.
What is the SMILES notation for (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine?
The canonical SMILES for (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine is [H]/N=C/C1(C)c2cc(C(C)(C)C)c#cc2-c2ccc(C)cc21.
What is the InChIKey of (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine?
The InChIKey is ASIZRWYYPMFQBA-CIAFOILYSA-N. The full InChI is InChI=1S/C20H21N/c1-13-6-8-15-16-9-7-14(19(2,3)4)11-18(16)20(5,12-21)17(15)10-13/h6,8,10-12,21H,1-5H3/b21-12+.
What are the key properties of (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine?
(2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine has a molecular weight of 275.39 g/mol, XLogP of 4.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-7,9-dimethyl-3,4-didehydrofluoren-9-yl)methanimine is sourced from PubChem (CID 89356100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).