C11H14F10O — CID 89356141
1,1,1,2-tetrafluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)-2,3-dimethylhexane (PubChem CID 89356141) has the molecular formula C11H14F10O and a molecular weight of 352.21 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)-2,3-dimethylhexane.
| Compound Name | 1,1,1,2-tetrafluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)-2,3-dimethylhexane |
|---|---|
| PubChem CID | 89356141 |
| Molecular Formula | C11H14F10O |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)-2,3-dimethylhexane |
| SMILES | CCCC(C)(OC(F)(F)C(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F10O/c1-4-5-7(2,8(3,13)11(19,20)21)22-10(17,18)6(12)9(14,15)16/h6H,4-5H2,1-3H3 |
| InChIKey | MOHMBPQRMKHKRW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |