About 4-methanimidoylpyridazine-3,5-diamine
4-methanimidoylpyridazine-3,5-diamine (PubChem CID 89356151) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 4-methanimidoylpyridazine-3,5-diamine.
Molecular Properties
| Compound Name | 4-methanimidoylpyridazine-3,5-diamine |
| PubChem CID | 89356151 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 4-methanimidoylpyridazine-3,5-diamine |
| SMILES | [H]/N=C/c1c(N)cnnc1N |
| InChI | InChI=1S/C5H7N5/c6-1-3-4(7)2-9-10-5(3)8/h1-2,6H,(H4,7,8,10)/b6-1+ |
| InChIKey | FCUKBEQNQBOYLB-LZCJLJQNSA-N |
| XLogP | -0.36 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methanimidoylpyridazine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methanimidoylpyridazine-3,5-diamine?
The IUPAC name of 4-methanimidoylpyridazine-3,5-diamine (CID 89356151) is 4-methanimidoylpyridazine-3,5-diamine.
What is the SMILES notation for 4-methanimidoylpyridazine-3,5-diamine?
The canonical SMILES for 4-methanimidoylpyridazine-3,5-diamine is [H]/N=C/c1c(N)cnnc1N.
What is the InChIKey of 4-methanimidoylpyridazine-3,5-diamine?
The InChIKey is FCUKBEQNQBOYLB-LZCJLJQNSA-N. The full InChI is InChI=1S/C5H7N5/c6-1-3-4(7)2-9-10-5(3)8/h1-2,6H,(H4,7,8,10)/b6-1+.
What are the key properties of 4-methanimidoylpyridazine-3,5-diamine?
4-methanimidoylpyridazine-3,5-diamine has a molecular weight of 137.15 g/mol, XLogP of -0.36, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methanimidoylpyridazine-3,5-diamine is sourced from PubChem (CID 89356151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).