C10H17N4O4+ — CID 89356532
[4,6-bis(hydroxymethyl)-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)-dimethylazanium (PubChem CID 89356532) has the molecular formula C10H17N4O4+ and a molecular weight of 257.27 g/mol. Its IUPAC name is [4,6-bis(hydroxymethyl)-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)-dimethylazanium.
| Compound Name | [4,6-bis(hydroxymethyl)-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)-dimethylazanium |
|---|---|
| PubChem CID | 89356532 |
| Molecular Formula | C10H17N4O4+ |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | [4,6-bis(hydroxymethyl)-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)-dimethylazanium |
| SMILES | COC(=O)C[N+](C)(C)c1nc(CO)nc(CO)n1 |
| InChI | InChI=1S/C10H17N4O4/c1-14(2,4-9(17)18-3)10-12-7(5-15)11-8(6-16)13-10/h15-16H,4-6H2,1-3H3/q+1 |
| InChIKey | PWYDBTBBNRQAST-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|