C7H14N2 — CID 89356558
4-propyl-1,4-diazabicyclo[3.1.0]hexane (PubChem CID 89356558) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 4-propyl-1,4-diazabicyclo[3.1.0]hexane.
| Compound Name | 4-propyl-1,4-diazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 89356558 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 4-propyl-1,4-diazabicyclo[3.1.0]hexane |
| SMILES | CCCN1CCN2CC12 |
| InChI | InChI=1S/C7H14N2/c1-2-3-8-4-5-9-6-7(8)9/h7H,2-6H2,1H3 |
| InChIKey | OFRIHNNIMHMIMB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|