About 1-fluoro-4-methyl-1,4-diazepane
1-fluoro-4-methyl-1,4-diazepane (PubChem CID 89356565) has the molecular formula C6H13FN2
and a molecular weight of 132.18 g/mol. Its IUPAC name is 1-fluoro-4-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-fluoro-4-methyl-1,4-diazepane |
| PubChem CID | 89356565 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | 1-fluoro-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(F)CC1 |
| InChI | InChI=1S/C6H13FN2/c1-8-3-2-4-9(7)6-5-8/h2-6H2,1H3 |
| InChIKey | GRCABVOLBCBJQC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methyl-1,4-diazepane?
The IUPAC name of 1-fluoro-4-methyl-1,4-diazepane (CID 89356565) is 1-fluoro-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-fluoro-4-methyl-1,4-diazepane?
The canonical SMILES for 1-fluoro-4-methyl-1,4-diazepane is CN1CCCN(F)CC1.
What is the InChIKey of 1-fluoro-4-methyl-1,4-diazepane?
The InChIKey is GRCABVOLBCBJQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FN2/c1-8-3-2-4-9(7)6-5-8/h2-6H2,1H3.
What are the key properties of 1-fluoro-4-methyl-1,4-diazepane?
1-fluoro-4-methyl-1,4-diazepane has a molecular weight of 132.18 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methyl-1,4-diazepane is sourced from PubChem (CID 89356565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).