About [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol
[4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol (PubChem CID 89357054) has the molecular formula C16H12F6O
and a molecular weight of 334.26 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol.
Molecular Properties
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol |
| PubChem CID | 89357054 |
| Molecular Formula | C16H12F6O |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol |
| SMILES | Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1CO |
| InChI | InChI=1S/C16H12F6O/c1-9-4-10(2-3-11(9)8-23)12-5-13(15(17,18)19)7-14(6-12)16(20,21)22/h2-7,23H,8H2,1H3 |
| InChIKey | OSNUEWDTVZKTHU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol?
The IUPAC name of [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol (CID 89357054) is [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol.
What is the SMILES notation for [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol?
The canonical SMILES for [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol is Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1CO.
What is the InChIKey of [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol?
The InChIKey is OSNUEWDTVZKTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F6O/c1-9-4-10(2-3-11(9)8-23)12-5-13(15(17,18)19)7-14(6-12)16(20,21)22/h2-7,23H,8H2,1H3.
What are the key properties of [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol?
[4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol has a molecular weight of 334.26 g/mol, XLogP of 5.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,5-bis(trifluoromethyl)phenyl]-2-methylphenyl]methanol is sourced from PubChem (CID 89357054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).