C23H25N3O3 — CID 89357084
ethyl N-[3-[(10cS)-1,10c-dihydropyren-4-yl]propylcarbamoylamino]carbamate (PubChem CID 89357084) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl N-[3-[(10cS)-1,10c-dihydropyren-4-yl]propylcarbamoylamino]carbamate.
| Compound Name | ethyl N-[3-[(10cS)-1,10c-dihydropyren-4-yl]propylcarbamoylamino]carbamate |
|---|---|
| PubChem CID | 89357084 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl N-[3-[(10cS)-1,10c-dihydropyren-4-yl]propylcarbamoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)NCCCC1=CC2=CC=CC3=CC=C4CC=CC1=C4[C@@H]32 |
| InChI | InChI=1S/C23H25N3O3/c1-2-29-23(28)26-25-22(27)24-13-5-9-17-14-18-8-3-6-15-11-12-16-7-4-10-19(17)21(16)20(15)18/h3-4,6,8,10-12,14,20H,2,5,7,9,13H2,1H3,(H,26,28)(H2,24,25,27)/t20-/m0/s1 |
| InChIKey | VLWKTIATVXKKBK-FQEVSTJZSA-N |
| XLogP | 3.90 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|