About 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane
1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane (PubChem CID 89357120) has the molecular formula C7H17N2O2S-
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane.
Molecular Properties
| Compound Name | 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane |
| PubChem CID | 89357120 |
| Molecular Formula | C7H17N2O2S- |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane |
| SMILES | CN(C)CC(C)(C)CNS(=O)[O-] |
| InChI | InChI=1S/C7H18N2O2S/c1-7(2,6-9(3)4)5-8-12(10)11/h8H,5-6H2,1-4H3,(H,10,11)/p-1 |
| InChIKey | AWMYYYCQCXTFPX-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane?
The IUPAC name of 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane (CID 89357120) is 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane.
What is the SMILES notation for 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane?
The canonical SMILES for 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane is CN(C)CC(C)(C)CNS(=O)[O-].
What is the InChIKey of 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane?
The InChIKey is AWMYYYCQCXTFPX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H18N2O2S/c1-7(2,6-9(3)4)5-8-12(10)11/h8H,5-6H2,1-4H3,(H,10,11)/p-1.
What are the key properties of 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane?
1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane has a molecular weight of 193.29 g/mol, XLogP of -0.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-2,2-dimethyl-3-(sulfinatoamino)propane is sourced from PubChem (CID 89357120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).