C23H18N2O — CID 89357147
2,9-dimethyl-14-methylidene-5,12-dihydroquinolino[2,3-b]acridin-7-one (PubChem CID 89357147) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is 2,9-dimethyl-14-methylidene-5,12-dihydroquinolino[2,3-b]acridin-7-one.
| Compound Name | 2,9-dimethyl-14-methylidene-5,12-dihydroquinolino[2,3-b]acridin-7-one |
|---|---|
| PubChem CID | 89357147 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2,9-dimethyl-14-methylidene-5,12-dihydroquinolino[2,3-b]acridin-7-one |
| SMILES | C=C1c2cc(C)ccc2Nc2cc3c(=O)c4cc(C)ccc4[nH]c3cc21 |
| InChI | InChI=1S/C23H18N2O/c1-12-4-6-19-15(8-12)14(3)16-10-22-18(11-21(16)24-19)23(26)17-9-13(2)5-7-20(17)25-22/h4-11,24H,3H2,1-2H3,(H,25,26) |
| InChIKey | RNTJYMLONWIGFR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|