C12H20F2O7S2 — CID 89357243
1,1-difluoro-2-[(1,2,2,3-tetramethyl-5-oxocyclopentyl)methylsulfonyloxy]ethanesulfonic acid (PubChem CID 89357243) has the molecular formula C12H20F2O7S2 and a molecular weight of 378.42 g/mol. Its IUPAC name is 1,1-difluoro-2-[(1,2,2,3-tetramethyl-5-oxocyclopentyl)methylsulfonyloxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(1,2,2,3-tetramethyl-5-oxocyclopentyl)methylsulfonyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 89357243 |
| Molecular Formula | C12H20F2O7S2 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1,1-difluoro-2-[(1,2,2,3-tetramethyl-5-oxocyclopentyl)methylsulfonyloxy]ethanesulfonic acid |
| SMILES | CC1CC(=O)C(C)(CS(=O)(=O)OCC(F)(F)S(=O)(=O)O)C1(C)C |
| InChI | InChI=1S/C12H20F2O7S2/c1-8-5-9(15)11(4,10(8,2)3)7-22(16,17)21-6-12(13,14)23(18,19)20/h8H,5-7H2,1-4H3,(H,18,19,20) |
| InChIKey | RHLAFPUDLAXCLY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|