C11H15NO — CID 89357254
N-[1-(3-methylcyclohexa-1,3,4-trien-1-yl)propan-2-yl]formamide (PubChem CID 89357254) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is N-[1-(3-methylcyclohexa-1,3,4-trien-1-yl)propan-2-yl]formamide.
| Compound Name | N-[1-(3-methylcyclohexa-1,3,4-trien-1-yl)propan-2-yl]formamide |
|---|---|
| PubChem CID | 89357254 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-[1-(3-methylcyclohexa-1,3,4-trien-1-yl)propan-2-yl]formamide |
| SMILES | CC1=C=CCC(CC(C)NC=O)=C1 |
| InChI | InChI=1S/C11H15NO/c1-9-4-3-5-11(6-9)7-10(2)12-8-13/h3,6,8,10H,5,7H2,1-2H3,(H,12,13) |
| InChIKey | ZIKHAMBDRWVXHA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|