About N',N"-diphenylmethanetriamine
N',N"-diphenylmethanetriamine (PubChem CID 89357309) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is N',N"-diphenylmethanetriamine.
Molecular Properties
| Compound Name | N',N"-diphenylmethanetriamine |
| PubChem CID | 89357309 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N',N"-diphenylmethanetriamine |
| SMILES | NC(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C13H15N3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10,13,15-16H,14H2 |
| InChIKey | VACYPRZHVJSIDH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N',N"-diphenylmethanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N"-diphenylmethanetriamine?
The IUPAC name of N',N"-diphenylmethanetriamine (CID 89357309) is N',N"-diphenylmethanetriamine.
What is the SMILES notation for N',N"-diphenylmethanetriamine?
The canonical SMILES for N',N"-diphenylmethanetriamine is NC(Nc1ccccc1)Nc1ccccc1.
What is the InChIKey of N',N"-diphenylmethanetriamine?
The InChIKey is VACYPRZHVJSIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10,13,15-16H,14H2.
What are the key properties of N',N"-diphenylmethanetriamine?
N',N"-diphenylmethanetriamine has a molecular weight of 213.28 g/mol, XLogP of 2.45, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N"-diphenylmethanetriamine is sourced from PubChem (CID 89357309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).