About 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole
3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole (PubChem CID 89357648) has the molecular formula C18H29N3O2
and a molecular weight of 319.45 g/mol. Its IUPAC name is 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole |
| PubChem CID | 89357648 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole |
| SMILES | C=CCO[C@@H]1CCN(C2CCCN(c3c(C)noc3C)CC2)C1 |
| InChI | InChI=1S/C18H29N3O2/c1-4-12-22-17-8-11-21(13-17)16-6-5-9-20(10-7-16)18-14(2)19-23-15(18)3/h4,16-17H,1,5-13H2,2-3H3/t16?,17-/m1/s1 |
| InChIKey | LDXBXFBKWRMXHC-ZYMOGRSISA-N |
| XLogP | 2.93 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole?
The IUPAC name of 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole (CID 89357648) is 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole.
What is the SMILES notation for 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole?
The canonical SMILES for 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole is C=CCO[C@@H]1CCN(C2CCCN(c3c(C)noc3C)CC2)C1.
What is the InChIKey of 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole?
The InChIKey is LDXBXFBKWRMXHC-ZYMOGRSISA-N. The full InChI is InChI=1S/C18H29N3O2/c1-4-12-22-17-8-11-21(13-17)16-6-5-9-20(10-7-16)18-14(2)19-23-15(18)3/h4,16-17H,1,5-13H2,2-3H3/t16?,17-/m1/s1.
What are the key properties of 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole?
3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole has a molecular weight of 319.45 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-[4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]azepan-1-yl]-1,2-oxazole is sourced from PubChem (CID 89357648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).