C26H29F4IN4O2 — CID 89357815
N-[2-[[(3R)-1-[1-[4-fluoro-3-(iodomethyl)phenyl]piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 89357815) has the molecular formula C26H29F4IN4O2 and a molecular weight of 632.44 g/mol. Its IUPAC name is N-[2-[[(3R)-1-[1-[4-fluoro-3-(iodomethyl)phenyl]piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(3R)-1-[1-[4-fluoro-3-(iodomethyl)phenyl]piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89357815 |
| Molecular Formula | C26H29F4IN4O2 |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | N-[2-[[(3R)-1-[1-[4-fluoro-3-(iodomethyl)phenyl]piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)N[C@@H]1CCN(C2CCN(c3ccc(F)c(CI)c3)CC2)C1 |
| InChI | InChI=1S/C26H29F4IN4O2/c27-23-5-4-22(13-18(23)14-31)34-10-7-21(8-11-34)35-9-6-20(16-35)33-24(36)15-32-25(37)17-2-1-3-19(12-17)26(28,29)30/h1-5,12-13,20-21H,6-11,14-16H2,(H,32,37)(H,33,36)/t20-/m1/s1 |
| InChIKey | FWBDCBNWTRNPNT-HXUWFJFHSA-N |
| XLogP | 4.37 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|