C18H13ClF4N2 — CID 89358003
4-chloro-6-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-2-[2-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 89358003) has the molecular formula C18H13ClF4N2 and a molecular weight of 368.76 g/mol. Its IUPAC name is 4-chloro-6-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-2-[2-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 4-chloro-6-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-2-[2-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 89358003 |
| Molecular Formula | C18H13ClF4N2 |
| Molecular Weight | 368.76 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 4-chloro-6-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-2-[2-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | C=C/C=C\C(F)=C(/C)c1cc(Cl)nc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C18H13ClF4N2/c1-3-4-9-14(20)11(2)15-10-16(19)25-17(24-15)12-7-5-6-8-13(12)18(21,22)23/h3-10H,1H2,2H3/b9-4-,14-11- |
| InChIKey | VSHGHFUHQZXZBN-ZWFPSRGRSA-N |
| XLogP | 6.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.76 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|