C7H12N2O — CID 89358076
(1E,3E)-2-methoxyhexa-1,3,5-triene-1,4-diamine (PubChem CID 89358076) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (1E,3E)-2-methoxyhexa-1,3,5-triene-1,4-diamine.
| Compound Name | (1E,3E)-2-methoxyhexa-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 89358076 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (1E,3E)-2-methoxyhexa-1,3,5-triene-1,4-diamine |
| SMILES | C=C/C(N)=C\C(=C/N)OC |
| InChI | InChI=1S/C7H12N2O/c1-3-6(9)4-7(5-8)10-2/h3-5H,1,8-9H2,2H3/b6-4+,7-5+ |
| InChIKey | WZURRHJHRNNQNU-YDFGWWAZSA-N |
| XLogP | 0.46 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|