About 3-methyl-5,6-dihydro-1H-isoindole
3-methyl-5,6-dihydro-1H-isoindole (PubChem CID 89358184) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 3-methyl-5,6-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 3-methyl-5,6-dihydro-1H-isoindole |
| PubChem CID | 89358184 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 3-methyl-5,6-dihydro-1H-isoindole |
| SMILES | CC1=NCC2=CCCC=C21 |
| InChI | InChI=1S/C9H11N/c1-7-9-5-3-2-4-8(9)6-10-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | IIUGLPQFLXXXGU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-5,6-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-dihydro-1H-isoindole?
The IUPAC name of 3-methyl-5,6-dihydro-1H-isoindole (CID 89358184) is 3-methyl-5,6-dihydro-1H-isoindole.
What is the SMILES notation for 3-methyl-5,6-dihydro-1H-isoindole?
The canonical SMILES for 3-methyl-5,6-dihydro-1H-isoindole is CC1=NCC2=CCCC=C21.
What is the InChIKey of 3-methyl-5,6-dihydro-1H-isoindole?
The InChIKey is IIUGLPQFLXXXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-7-9-5-3-2-4-8(9)6-10-7/h4-5H,2-3,6H2,1H3.
What are the key properties of 3-methyl-5,6-dihydro-1H-isoindole?
3-methyl-5,6-dihydro-1H-isoindole has a molecular weight of 133.19 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-dihydro-1H-isoindole is sourced from PubChem (CID 89358184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).