About N-butyl-N,4-dimethylpent-3-en-1-amine
N-butyl-N,4-dimethylpent-3-en-1-amine (PubChem CID 89358339) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is N-butyl-N,4-dimethylpent-3-en-1-amine.
Molecular Properties
| Compound Name | N-butyl-N,4-dimethylpent-3-en-1-amine |
| PubChem CID | 89358339 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N-butyl-N,4-dimethylpent-3-en-1-amine |
| SMILES | CCCCN(C)CCC=C(C)C |
| InChI | InChI=1S/C11H23N/c1-5-6-9-12(4)10-7-8-11(2)3/h8H,5-7,9-10H2,1-4H3 |
| InChIKey | DZWLXVKKJRXHAL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N,4-dimethylpent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,4-dimethylpent-3-en-1-amine?
The IUPAC name of N-butyl-N,4-dimethylpent-3-en-1-amine (CID 89358339) is N-butyl-N,4-dimethylpent-3-en-1-amine.
What is the SMILES notation for N-butyl-N,4-dimethylpent-3-en-1-amine?
The canonical SMILES for N-butyl-N,4-dimethylpent-3-en-1-amine is CCCCN(C)CCC=C(C)C.
What is the InChIKey of N-butyl-N,4-dimethylpent-3-en-1-amine?
The InChIKey is DZWLXVKKJRXHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-5-6-9-12(4)10-7-8-11(2)3/h8H,5-7,9-10H2,1-4H3.
What are the key properties of N-butyl-N,4-dimethylpent-3-en-1-amine?
N-butyl-N,4-dimethylpent-3-en-1-amine has a molecular weight of 169.31 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,4-dimethylpent-3-en-1-amine is sourced from PubChem (CID 89358339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).