About 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine
4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 89358489) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 89358489 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | FC1C=CC(C2CCNCC2)=CC1 |
| InChI | InChI=1S/C11H16FN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-3,10-11,13H,4-8H2 |
| InChIKey | HRVMMSGYCAWTIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine (CID 89358489) is 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine is FC1C=CC(C2CCNCC2)=CC1.
What is the InChIKey of 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is HRVMMSGYCAWTIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-3,10-11,13H,4-8H2.
What are the key properties of 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine?
4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 181.25 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 89358489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).