About (E)-1,10-dimethoxy-6-methyldec-5-en-4-one
(E)-1,10-dimethoxy-6-methyldec-5-en-4-one (PubChem CID 89358514) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is (E)-1,10-dimethoxy-6-methyldec-5-en-4-one.
Molecular Properties
| Compound Name | (E)-1,10-dimethoxy-6-methyldec-5-en-4-one |
| PubChem CID | 89358514 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (E)-1,10-dimethoxy-6-methyldec-5-en-4-one |
| SMILES | COCCCC/C(C)=C/C(=O)CCCOC |
| InChI | InChI=1S/C13H24O3/c1-12(7-4-5-9-15-2)11-13(14)8-6-10-16-3/h11H,4-10H2,1-3H3/b12-11+ |
| InChIKey | XDNUDHAUCUMEIL-VAWYXSNFSA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,10-dimethoxy-6-methyldec-5-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,10-dimethoxy-6-methyldec-5-en-4-one?
The IUPAC name of (E)-1,10-dimethoxy-6-methyldec-5-en-4-one (CID 89358514) is (E)-1,10-dimethoxy-6-methyldec-5-en-4-one.
What is the SMILES notation for (E)-1,10-dimethoxy-6-methyldec-5-en-4-one?
The canonical SMILES for (E)-1,10-dimethoxy-6-methyldec-5-en-4-one is COCCCC/C(C)=C/C(=O)CCCOC.
What is the InChIKey of (E)-1,10-dimethoxy-6-methyldec-5-en-4-one?
The InChIKey is XDNUDHAUCUMEIL-VAWYXSNFSA-N. The full InChI is InChI=1S/C13H24O3/c1-12(7-4-5-9-15-2)11-13(14)8-6-10-16-3/h11H,4-10H2,1-3H3/b12-11+.
What are the key properties of (E)-1,10-dimethoxy-6-methyldec-5-en-4-one?
(E)-1,10-dimethoxy-6-methyldec-5-en-4-one has a molecular weight of 228.33 g/mol, XLogP of 2.75, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,10-dimethoxy-6-methyldec-5-en-4-one is sourced from PubChem (CID 89358514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).